4-Fluoro-5-hydroxy-2-methylindole

Reputable factory supply 4-Fluoro-5-hydroxy-2-methylindole 288385-88-6 in stock with high standard We provide high quality 4-Fluoro-5-hydroxy-2-methylindole (CAS 288385-88-6), at a very affordable prices to our customers.

1.What is the 4-Fluoro-5-hydroxy-2-methylindole ?

4-Fluoro-5-hydroxy-2-methylindole is a chemical compound with the formula C9H8FNO and a molar mass of 175.2 g/mol. It is a derivative of 2-methylindole, featuring a fluorine atom and a hydroxy group on the 5th position of the indole ring. 4-Fluoro-5-hydroxy-2-methylindole is known for its biological activity and is primarily used in organic synthesis, particularly within the pharmaceutical industry for the development of new drugs. Its specific properties and potential applications are still under investigation.

Used in Pharmaceutical Industry:
4-Fluoro-5-hydroxy-2-methylindole is used as a chemical intermediate for the synthesis of new drugs due to its unique structure and biological activity. Its presence of a fluorine atom and a hydroxy group on the indole ring may contribute to the development of pharmaceuticals with novel therapeutic properties.
Used in Organic Synthesis:
In the field of organic synthesis, 4-Fluoro-5-hydroxy-2-methylindole serves as a key building block for the creation of various organic compounds. Its unique functional groups allow for further chemical reactions and modifications, leading to the formation of new molecules with potential applications in various industries.
While the specific applications and reasons for using 4-Fluoro-5-hydroxy-2-methylindole in different industries are still under investigation, its role in pharmaceutical development and organic synthesis highlights its potential as a valuable compound in the scientific community. Further research is needed to fully understand its capabilities and optimize its use in various applications.

2.What is the CAS number for 4-Fluoro-5-hydroxy-2-methylindole ?

The CAS number of 4-Fluoro-5-hydroxy-2-methylindole is 288385-88-6.

More information of 4-Fluoro-5-hydroxy-2-methylindole 288385-88-6 are:

3.What is the molecular formula of 4-Fluoro-5-hydroxy-2-methylindole ?

The chemical formula of?4-Fluoro-5-hydroxy-2-methylindole is C9H8FNO which containing 9 Carbon atoms,8 Hydrogen atoms,1 Fluorine atoms,1 Nitrogen atoms and 1 Oxygen atoms,and the molecular weight, and the molecular weight of 4-Fluoro-5-hydroxy-2-methylindole is 165.167

4.What is 4-Fluoro-5-hydroxy-2-methylindole(288385-88-6)used for?

4-Fluoro-5-hydroxy-2-methylindole is a chemical compound with the formula C9H8FNO and a molar mass of 175.2 g/mol. It is a derivative of 2-methylindole, featuring a fluorine atom and a hydroxy group on the 5th position of the indole ring. 4-Fluoro-5-hydroxy-2-methylindole is known for its biological activity and is primarily used in organic synthesis, particularly within the pharmaceutical industry for the development of new drugs. Its specific properties and potential applications are still under investigation.

InChI:InChI=1/C9H8FNO/c1-5-4-6-7(11-5)2-3-8(12)9(6)10/h2-4,11-12H,1H3

Relevant articles related to 4-Fluoro-5-hydroxy-2-methylindole:

5.Reputable factory supply 4-Fluoro-5-hydroxy-2-methylindole 288385-88-6 in stock with high standard

Qingdao runxing photoelectric material co.,ltd. is a quality supplier of 4-Fluoro-5-hydroxy-2-methylindole. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 4-Fluoro-5-hydroxy-2-methylindole 288385-88-6.